| Name | 2-Ethoxybenzaldehyde |
| Synonyms | AKOS B029848 ASISCHEM R42365 AKOS BBS-00003145 O-ETHOXYBENZALDEHYDE 2-Ethoxybenzaldehyde 2-ETHOXYBENZALDEHYDE 2-Ethoxylbenzaldehyde LABOTEST-BB LT00616095 Benzaldehyde, o-ethoxy- SALICYLALDEHYDE ETHYL ETHER N,N-dimethyl-4-[(E)-naphthalen-2-yldiazenyl]aniline |
| CAS | 613-69-4 |
| EINECS | 210-349-2 |
| InChI | InChI=1/C18H17N3/c1-21(2)18-11-9-16(10-12-18)19-20-17-8-7-14-5-3-4-6-15(14)13-17/h3-13H,1-2H3/b20-19+ |
| Molecular Formula | C9H10O2 |
| Molar Mass | 150.17 |
| Density | 1.074 g/mL at 25 °C (lit.) |
| Melting Point | 20-22 C |
| Boling Point | 136-138 °C/24 mmHg (lit.) |
| Flash Point | 197°F |
| Vapor Presure | 1.06E-08mmHg at 25°C |
| BRN | 1937270 |
| Storage Condition | under inert gas (nitrogen or Argon) at 2-8°C |
| Sensitive | Air Sensitive |
| Refractive Index | n20/D 1.543(lit.) |
| Use | Used as a pharmaceutical Intermediate |
| Hazard Symbols | Xi - Irritant![]() |
| Risk Codes | 36/37/38 - Irritating to eyes, respiratory system and skin. |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S37/39 - Wear suitable gloves and eye/face protection S36 - Wear suitable protective clothing. |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29122990 |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| use | as a pharmaceutical intermediate for the synthesis of diclofenac, a highly effective anti-inflammatory drug |